C24H20F3N3 — CID 46085852
N-benzyl-N-ethyl-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 46085852) has the molecular formula C24H20F3N3 and a molecular weight of 407.44 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | N-benzyl-N-ethyl-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 46085852 |
| Molecular Formula | C24H20F3N3 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-benzyl-N-ethyl-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | CCN(Cc1ccccc1)c1nc(-c2ccccc2C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C24H20F3N3/c1-2-30(16-17-10-4-3-5-11-17)23-19-13-7-9-15-21(19)28-22(29-23)18-12-6-8-14-20(18)24(25,26)27/h3-15H,2,16H2,1H3 |
| InChIKey | KGTDAFIUFAIJNY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |