C22H28N4O8S2 — CID 46088942
4-methoxy-3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 46088942) has the molecular formula C22H28N4O8S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-methoxy-3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46088942 |
| Molecular Formula | C22H28N4O8S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 4-methoxy-3-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2CCCO2)cc1N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H28N4O8S2/c1-33-22-8-7-19(35(29,30)23-16-18-5-3-13-34-18)15-21(22)24-9-11-25(12-10-24)36(31,32)20-6-2-4-17(14-20)26(27)28/h2,4,6-8,14-15,18,23H,3,5,9-13,16H2,1H3 |
| InChIKey | SKYUAQPPKLNLJJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|