C19H12Cl2F2N2O — CID 46089627
2,2-dichloro-N-[3-[6-(2,4-difluorophenyl)-2-pyridinyl]phenyl]acetamide (PubChem CID 46089627) has the molecular formula C19H12Cl2F2N2O and a molecular weight of 393.22 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[6-(2,4-difluorophenyl)-2-pyridinyl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[6-(2,4-difluorophenyl)-2-pyridinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46089627 |
| Molecular Formula | C19H12Cl2F2N2O |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2,2-dichloro-N-[3-[6-(2,4-difluorophenyl)-2-pyridinyl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(-c2cccc(-c3ccc(F)cc3F)n2)c1)C(Cl)Cl |
| InChI | InChI=1S/C19H12Cl2F2N2O/c20-18(21)19(26)24-13-4-1-3-11(9-13)16-5-2-6-17(25-16)14-8-7-12(22)10-15(14)23/h1-10,18H,(H,24,26) |
| InChIKey | NRJVVJQYIYBGJQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|