C23H28N2O2S — CID 46089981
7-methyl-3-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]-1H-indole (PubChem CID 46089981) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 7-methyl-3-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]-1H-indole.
| Compound Name | 7-methyl-3-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 46089981 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 7-methyl-3-[1-(4-propylphenyl)sulfonylpiperidin-4-yl]-1H-indole |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCC(c3c[nH]c4c(C)cccc34)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O2S/c1-3-5-18-8-10-20(11-9-18)28(26,27)25-14-12-19(13-15-25)22-16-24-23-17(2)6-4-7-21(22)23/h4,6-11,16,19,24H,3,5,12-15H2,1-2H3 |
| InChIKey | JLPKCWQDGGQPPJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |