C24H21F5N4O3 — CID 46093104
ethyl 6,7-dimethyl-3-[4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]quinoxaline-2-carboxylate (PubChem CID 46093104) has the molecular formula C24H21F5N4O3 and a molecular weight of 508.45 g/mol. Its IUPAC name is ethyl 6,7-dimethyl-3-[4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 6,7-dimethyl-3-[4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 46093104 |
| Molecular Formula | C24H21F5N4O3 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | ethyl 6,7-dimethyl-3-[4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cc(C)c(C)cc2nc1N1CCN(C(=O)c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C24H21F5N4O3/c1-4-36-24(35)21-22(31-14-10-12(3)11(2)9-13(14)30-21)32-5-7-33(8-6-32)23(34)15-16(25)18(27)20(29)19(28)17(15)26/h9-10H,4-8H2,1-3H3 |
| InChIKey | NSWBCBGFAMQEJI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|