C21H17F5N4O4S — CID 46093651
ethyl 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate (PubChem CID 46093651) has the molecular formula C21H17F5N4O4S and a molecular weight of 516.45 g/mol. Its IUPAC name is ethyl 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 46093651 |
| Molecular Formula | C21H17F5N4O4S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | ethyl 3-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2nc1N1CCN(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H17F5N4O4S/c1-2-34-21(31)18-20(28-12-6-4-3-5-11(12)27-18)29-7-9-30(10-8-29)35(32,33)19-16(25)14(23)13(22)15(24)17(19)26/h3-6H,2,7-10H2,1H3 |
| InChIKey | NCPVIXVIXGEQIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|