C19H23ClN4O3 — CID 92760525
ethyl 3-[4-[(2R)-2-chloropropanoyl]-1,4-diazepan-1-yl]quinoxaline-2-carboxylate (PubChem CID 92760525) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is ethyl 3-[4-[(2R)-2-chloropropanoyl]-1,4-diazepan-1-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 3-[4-[(2R)-2-chloropropanoyl]-1,4-diazepan-1-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 92760525 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | ethyl 3-[4-[(2R)-2-chloropropanoyl]-1,4-diazepan-1-yl]quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2nc1N1CCCN(C(=O)[C@@H](C)Cl)CC1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-3-27-19(26)16-17(22-15-8-5-4-7-14(15)21-16)23-9-6-10-24(12-11-23)18(25)13(2)20/h4-5,7-8,13H,3,6,9-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | TZBIVEDEZWCFOH-CYBMUJFWSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|