C22H22ClN5O3 — CID 46093128
ethyl 3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate (PubChem CID 46093128) has the molecular formula C22H22ClN5O3 and a molecular weight of 439.90 g/mol. Its IUPAC name is ethyl 3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 46093128 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | ethyl 3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2nc1N1CCCN(C(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C22H22ClN5O3/c1-2-31-22(30)18-20(26-17-9-4-3-8-16(17)25-18)27-11-6-12-28(14-13-27)21(29)15-7-5-10-24-19(15)23/h3-5,7-10H,2,6,11-14H2,1H3 |
| InChIKey | YGADLFIPFGURSG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|