C22H20Cl3N5O3 — CID 46093613
ethyl 6,7-dichloro-3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate (PubChem CID 46093613) has the molecular formula C22H20Cl3N5O3 and a molecular weight of 508.79 g/mol. Its IUPAC name is ethyl 6,7-dichloro-3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 6,7-dichloro-3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 46093613 |
| Molecular Formula | C22H20Cl3N5O3 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | ethyl 6,7-dichloro-3-[4-(2-chloropyridine-3-carbonyl)-1,4-diazepan-1-yl]quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cc(Cl)c(Cl)cc2nc1N1CCCN(C(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C22H20Cl3N5O3/c1-2-33-22(32)18-20(28-17-12-15(24)14(23)11-16(17)27-18)29-7-4-8-30(10-9-29)21(31)13-5-3-6-26-19(13)25/h3,5-6,11-12H,2,4,7-10H2,1H3 |
| InChIKey | OSPBNCLBRPANET-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|