C23H25N5O5S — CID 46093646
ethyl 3-[4-(4-acetamidophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate (PubChem CID 46093646) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is ethyl 3-[4-(4-acetamidophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate.
| Compound Name | ethyl 3-[4-(4-acetamidophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 46093646 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | ethyl 3-[4-(4-acetamidophenyl)sulfonylpiperazin-1-yl]quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2nc1N1CCN(S(=O)(=O)c2ccc(NC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C23H25N5O5S/c1-3-33-23(30)21-22(26-20-7-5-4-6-19(20)25-21)27-12-14-28(15-13-27)34(31,32)18-10-8-17(9-11-18)24-16(2)29/h4-11H,3,12-15H2,1-2H3,(H,24,29) |
| InChIKey | BMFZLULWBMAHCV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |