C26H37N3O3 — CID 46097768
ethyl 5-tert-butyl-1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]pyrazole-3-carboxylate (PubChem CID 46097768) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46097768 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | ethyl 5-tert-butyl-1-[1-(4-tert-butylbenzoyl)piperidin-4-yl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)(C)C)n(C2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)n1 |
| InChI | InChI=1S/C26H37N3O3/c1-8-32-24(31)21-17-22(26(5,6)7)29(27-21)20-13-15-28(16-14-20)23(30)18-9-11-19(12-10-18)25(2,3)4/h9-12,17,20H,8,13-16H2,1-7H3 |
| InChIKey | ZLTDERYUSXHVKC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |