C23H26ClF2N3O3S2 — CID 46097892
2-[(2-chloro-3,6-difluorophenyl)methylsulfanyl]-N,N-diethyl-1-(oxolan-2-ylmethyl)benzimidazole-5-sulfonamide (PubChem CID 46097892) has the molecular formula C23H26ClF2N3O3S2 and a molecular weight of 530.06 g/mol. Its IUPAC name is 2-[(2-chloro-3,6-difluorophenyl)methylsulfanyl]-N,N-diethyl-1-(oxolan-2-ylmethyl)benzimidazole-5-sulfonamide.
| Compound Name | 2-[(2-chloro-3,6-difluorophenyl)methylsulfanyl]-N,N-diethyl-1-(oxolan-2-ylmethyl)benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 46097892 |
| Molecular Formula | C23H26ClF2N3O3S2 |
| Molecular Weight | 530.06 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 2-[(2-chloro-3,6-difluorophenyl)methylsulfanyl]-N,N-diethyl-1-(oxolan-2-ylmethyl)benzimidazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SCc1c(F)ccc(F)c1Cl)n2CC1CCCO1 |
| InChI | InChI=1S/C23H26ClF2N3O3S2/c1-3-28(4-2)34(30,31)16-7-10-21-20(12-16)27-23(29(21)13-15-6-5-11-32-15)33-14-17-18(25)8-9-19(26)22(17)24/h7-10,12,15H,3-6,11,13-14H2,1-2H3 |
| InChIKey | FIBPQODIPYHVTK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|