C25H31N3O5S2 — CID 46098003
[2-[[5-(diethylsulfamoyl)-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylmethyl]phenyl] acetate (PubChem CID 46098003) has the molecular formula C25H31N3O5S2 and a molecular weight of 517.67 g/mol. Its IUPAC name is [2-[[5-(diethylsulfamoyl)-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylmethyl]phenyl] acetate.
| Compound Name | [2-[[5-(diethylsulfamoyl)-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylmethyl]phenyl] acetate |
|---|---|
| PubChem CID | 46098003 |
| Molecular Formula | C25H31N3O5S2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | [2-[[5-(diethylsulfamoyl)-1-(oxolan-2-ylmethyl)benzimidazol-2-yl]sulfanylmethyl]phenyl] acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SCc1ccccc1OC(C)=O)n2CC1CCCO1 |
| InChI | InChI=1S/C25H31N3O5S2/c1-4-27(5-2)35(30,31)21-12-13-23-22(15-21)26-25(28(23)16-20-10-8-14-32-20)34-17-19-9-6-7-11-24(19)33-18(3)29/h6-7,9,11-13,15,20H,4-5,8,10,14,16-17H2,1-3H3 |
| InChIKey | YHYUQQCCWBRHJZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|