C24H27N3O4S2 — CID 46097818
[2-[[1-(cyclopropylmethyl)-5-pyrrolidin-1-ylsulfonylbenzimidazol-2-yl]sulfanylmethyl]phenyl] acetate (PubChem CID 46097818) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is [2-[[1-(cyclopropylmethyl)-5-pyrrolidin-1-ylsulfonylbenzimidazol-2-yl]sulfanylmethyl]phenyl] acetate.
| Compound Name | [2-[[1-(cyclopropylmethyl)-5-pyrrolidin-1-ylsulfonylbenzimidazol-2-yl]sulfanylmethyl]phenyl] acetate |
|---|---|
| PubChem CID | 46097818 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | [2-[[1-(cyclopropylmethyl)-5-pyrrolidin-1-ylsulfonylbenzimidazol-2-yl]sulfanylmethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1CSc1nc2cc(S(=O)(=O)N3CCCC3)ccc2n1CC1CC1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-17(28)31-23-7-3-2-6-19(23)16-32-24-25-21-14-20(33(29,30)26-12-4-5-13-26)10-11-22(21)27(24)15-18-8-9-18/h2-3,6-7,10-11,14,18H,4-5,8-9,12-13,15-16H2,1H3 |
| InChIKey | OWKPHCFLSZJUNS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|