About 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide
5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 46099797) has the molecular formula C24H25BrN2O6S
and a molecular weight of 549.44 g/mol. Its IUPAC name is 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide.
Molecular Properties
| Compound Name | 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide |
| PubChem CID | 46099797 |
| Molecular Formula | C24H25BrN2O6S |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(Br)ccc2NS(=O)(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H25BrN2O6S/c1-31-18-7-4-16(5-8-18)12-13-26-24(28)20-14-17(25)6-10-21(20)27-34(29,30)23-11-9-19(32-2)15-22(23)33-3/h4-11,14-15,27H,12-13H2,1-3H3,(H,26,28) |
| InChIKey | LERWVJQSSDKSJI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide?
The IUPAC name of 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide (CID 46099797) is 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide.
What is the SMILES notation for 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide?
The canonical SMILES for 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide is COc1ccc(CCNC(=O)c2cc(Br)ccc2NS(=O)(=O)c2ccc(OC)cc2OC)cc1.
What is the InChIKey of 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide?
The InChIKey is LERWVJQSSDKSJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25BrN2O6S/c1-31-18-7-4-16(5-8-18)12-13-26-24(28)20-14-17(25)6-10-21(20)27-34(29,30)23-11-9-19(32-2)15-22(23)33-3/h4-11,14-15,27H,12-13H2,1-3H3,(H,26,28).
What are the key properties of 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide?
5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide has a molecular weight of 549.44 g/mol, XLogP of 4.25, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-[2-(4-methoxyphenyl)ethyl]benzamide is sourced from PubChem (CID 46099797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).