C23H30N2O4 — CID 46101173
ethyl 7-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)anilino]-7-oxoheptanoate (PubChem CID 46101173) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is ethyl 7-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)anilino]-7-oxoheptanoate.
| Compound Name | ethyl 7-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)anilino]-7-oxoheptanoate |
|---|---|
| PubChem CID | 46101173 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | ethyl 7-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)anilino]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)Nc1cc(-c2onc3c2CCCC3)ccc1C |
| InChI | InChI=1S/C23H30N2O4/c1-3-28-22(27)12-6-4-5-11-21(26)24-20-15-17(14-13-16(20)2)23-18-9-7-8-10-19(18)25-29-23/h13-15H,3-12H2,1-2H3,(H,24,26) |
| InChIKey | HKLZLIAILMJYDR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|