C21H27N3O4 — CID 46105384
ethyl 1-[1-ethyl-3-(2-methoxyphenyl)pyrazole-5-carbonyl]piperidine-3-carboxylate (PubChem CID 46105384) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is ethyl 1-[1-ethyl-3-(2-methoxyphenyl)pyrazole-5-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-ethyl-3-(2-methoxyphenyl)pyrazole-5-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46105384 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | ethyl 1-[1-ethyl-3-(2-methoxyphenyl)pyrazole-5-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc(-c3ccccc3OC)nn2CC)C1 |
| InChI | InChI=1S/C21H27N3O4/c1-4-24-18(13-17(22-24)16-10-6-7-11-19(16)27-3)20(25)23-12-8-9-15(14-23)21(26)28-5-2/h6-7,10-11,13,15H,4-5,8-9,12,14H2,1-3H3 |
| InChIKey | VKTCXXBHGPUUQS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |