C30H38ClN3O4 — CID 46105732
N-[4-[benzyl-(4-methoxybenzoyl)amino]cyclohexyl]-1-(3-chloropropanoyl)piperidine-4-carboxamide (PubChem CID 46105732) has the molecular formula C30H38ClN3O4 and a molecular weight of 540.10 g/mol. Its IUPAC name is N-[4-[benzyl-(4-methoxybenzoyl)amino]cyclohexyl]-1-(3-chloropropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-[benzyl-(4-methoxybenzoyl)amino]cyclohexyl]-1-(3-chloropropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46105732 |
| Molecular Formula | C30H38ClN3O4 |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | N-[4-[benzyl-(4-methoxybenzoyl)amino]cyclohexyl]-1-(3-chloropropanoyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)N(Cc2ccccc2)C2CCC(NC(=O)C3CCN(C(=O)CCCl)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H38ClN3O4/c1-38-27-13-7-24(8-14-27)30(37)34(21-22-5-3-2-4-6-22)26-11-9-25(10-12-26)32-29(36)23-16-19-33(20-17-23)28(35)15-18-31/h2-8,13-14,23,25-26H,9-12,15-21H2,1H3,(H,32,36) |
| InChIKey | NBTSUBOWBBHSKM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|