C33H44FN3O3 — CID 46105695
N-[4-[(4-fluorobenzoyl)-[(3-methylphenyl)methyl]amino]cyclohexyl]-1-hexanoylpiperidine-4-carboxamide (PubChem CID 46105695) has the molecular formula C33H44FN3O3 and a molecular weight of 549.73 g/mol. Its IUPAC name is N-[4-[(4-fluorobenzoyl)-[(3-methylphenyl)methyl]amino]cyclohexyl]-1-hexanoylpiperidine-4-carboxamide.
| Compound Name | N-[4-[(4-fluorobenzoyl)-[(3-methylphenyl)methyl]amino]cyclohexyl]-1-hexanoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46105695 |
| Molecular Formula | C33H44FN3O3 |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | N-[4-[(4-fluorobenzoyl)-[(3-methylphenyl)methyl]amino]cyclohexyl]-1-hexanoylpiperidine-4-carboxamide |
| SMILES | CCCCCC(=O)N1CCC(C(=O)NC2CCC(N(Cc3cccc(C)c3)C(=O)c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C33H44FN3O3/c1-3-4-5-9-31(38)36-20-18-26(19-21-36)32(39)35-29-14-16-30(17-15-29)37(23-25-8-6-7-24(2)22-25)33(40)27-10-12-28(34)13-11-27/h6-8,10-13,22,26,29-30H,3-5,9,14-21,23H2,1-2H3,(H,35,39) |
| InChIKey | WTHGZJNEUYEGNK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|