C6H4F2N3O2- — CID 4610584
2-[(2,6-difluoropyrimidin-4-yl)amino]acetate (PubChem CID 4610584) has the molecular formula C6H4F2N3O2- and a molecular weight of 188.11 g/mol. Its IUPAC name is 2-[(2,6-difluoropyrimidin-4-yl)amino]acetate.
| Compound Name | 2-[(2,6-difluoropyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 4610584 |
| Molecular Formula | C6H4F2N3O2- |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-[(2,6-difluoropyrimidin-4-yl)amino]acetate |
| SMILES | O=C([O-])CNc1cc(F)nc(F)n1 |
| InChI | InChI=1S/C6H5F2N3O2/c7-3-1-4(9-2-5(12)13)11-6(8)10-3/h1H,2H2,(H,12,13)(H,9,10,11)/p-1 |
| InChIKey | LLMMBHLJZPPNJY-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |