C7H7F2N3 — CID 164647775
2,6-difluoro-N-prop-2-enylpyrimidin-4-amine (PubChem CID 164647775) has the molecular formula C7H7F2N3 and a molecular weight of 171.15 g/mol. Its IUPAC name is 2,6-difluoro-N-prop-2-enylpyrimidin-4-amine.
| Compound Name | 2,6-difluoro-N-prop-2-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 164647775 |
| Molecular Formula | C7H7F2N3 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2,6-difluoro-N-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCNc1cc(F)nc(F)n1 |
| InChI | InChI=1S/C7H7F2N3/c1-2-3-10-6-4-5(8)11-7(9)12-6/h2,4H,1,3H2,(H,10,11,12) |
| InChIKey | RDDBARIQAVWJCV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|