C23H19ClN2O3S — CID 46107748
2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole (PubChem CID 46107748) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 46107748 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCCC1c1nc2cc(-c3ccccc3)ccc2o1 |
| InChI | InChI=1S/C23H19ClN2O3S/c24-18-9-11-19(12-10-18)30(27,28)26-14-4-7-21(26)23-25-20-15-17(8-13-22(20)29-23)16-5-2-1-3-6-16/h1-3,5-6,8-13,15,21H,4,7,14H2 |
| InChIKey | ZBUWANUYGYRJEF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |