C22H26N2O3S — CID 93016277
2-[(2R)-1-butylsulfonylpyrrolidin-2-yl]-5-(2-methylphenyl)-1,3-benzoxazole (PubChem CID 93016277) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[(2R)-1-butylsulfonylpyrrolidin-2-yl]-5-(2-methylphenyl)-1,3-benzoxazole.
| Compound Name | 2-[(2R)-1-butylsulfonylpyrrolidin-2-yl]-5-(2-methylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 93016277 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[(2R)-1-butylsulfonylpyrrolidin-2-yl]-5-(2-methylphenyl)-1,3-benzoxazole |
| SMILES | CCCCS(=O)(=O)N1CCC[C@@H]1c1nc2cc(-c3ccccc3C)ccc2o1 |
| InChI | InChI=1S/C22H26N2O3S/c1-3-4-14-28(25,26)24-13-7-10-20(24)22-23-19-15-17(11-12-21(19)27-22)18-9-6-5-8-16(18)2/h5-6,8-9,11-12,15,20H,3-4,7,10,13-14H2,1-2H3/t20-/m1/s1 |
| InChIKey | WFFQGQUCYTVPOP-HXUWFJFHSA-N |
| XLogP | 5.07 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |