C27H22N2O3S — CID 93016250
2-[(2R)-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole (PubChem CID 93016250) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[(2R)-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole.
| Compound Name | 2-[(2R)-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 93016250 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-[(2R)-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl]-5-phenyl-1,3-benzoxazole |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCC[C@@H]1c1nc2cc(-c3ccccc3)ccc2o1 |
| InChI | InChI=1S/C27H22N2O3S/c30-33(31,23-14-12-20-9-4-5-10-21(20)17-23)29-16-6-11-25(29)27-28-24-18-22(13-15-26(24)32-27)19-7-2-1-3-8-19/h1-5,7-10,12-15,17-18,25H,6,11,16H2/t25-/m1/s1 |
| InChIKey | FPYXEGMGOXTCQE-RUZDIDTESA-N |
| XLogP | 6.17 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |