C21H21N5O5S — CID 46136405
N-(furan-2-ylmethyl)-1-[2-(4-nitroanilino)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide (PubChem CID 46136405) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[2-(4-nitroanilino)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-[2-(4-nitroanilino)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46136405 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[2-(4-nitroanilino)-1,3-thiazole-4-carbonyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCCN(C(=O)c2csc(Nc3ccc([N+](=O)[O-])cc3)n2)C1 |
| InChI | InChI=1S/C21H21N5O5S/c27-19(22-11-17-4-2-10-31-17)14-3-1-9-25(12-14)20(28)18-13-32-21(24-18)23-15-5-7-16(8-6-15)26(29)30/h2,4-8,10,13-14H,1,3,9,11-12H2,(H,22,27)(H,23,24) |
| InChIKey | GGBKMVARVARYGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|