C22H32N4O3S — CID 46137705
N-[[5-(tert-butylcarbamoylamino)-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide (PubChem CID 46137705) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[[5-(tert-butylcarbamoylamino)-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide.
| Compound Name | N-[[5-(tert-butylcarbamoylamino)-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46137705 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[[5-(tert-butylcarbamoylamino)-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
| SMILES | COCCN(Cc1cc(NC(=O)NC(C)(C)C)ccc1N(C)C)C(=O)c1cccs1 |
| InChI | InChI=1S/C22H32N4O3S/c1-22(2,3)24-21(28)23-17-9-10-18(25(4)5)16(14-17)15-26(11-12-29-6)20(27)19-8-7-13-30-19/h7-10,13-14H,11-12,15H2,1-6H3,(H2,23,24,28) |
| InChIKey | XMXOGWNOORZGJN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|