C24H27ClN4O4 — CID 46138978
3-[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 46138978) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 3-[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 46138978 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | Cc1[nH]n(-c2ccc(Cl)cc2)c(=O)c1C1=C(N2CCOCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C24H27ClN4O4/c1-15-19(23(31)29(26-15)18-9-7-16(25)8-10-18)20-21(27-11-13-33-14-12-27)24(32)28(22(20)30)17-5-3-2-4-6-17/h7-10,17,26H,2-6,11-14H2,1H3 |
| InChIKey | WYIMIURWGOVJQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|