C14H19ClN2O3 — CID 15006064
3-chloro-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 15006064) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 3-chloro-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 3-chloro-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 15006064 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-chloro-1-cyclohexyl-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(N2CCOCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C14H19ClN2O3/c15-11-12(16-6-8-20-9-7-16)14(19)17(13(11)18)10-4-2-1-3-5-10/h10H,1-9H2 |
| InChIKey | OVIJIMRJIBVRLO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|