C21H24ClN3O5 — CID 20795749
3-chloro-1-cyclohexyl-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione (PubChem CID 20795749) has the molecular formula C21H24ClN3O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is 3-chloro-1-cyclohexyl-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-cyclohexyl-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 20795749 |
| Molecular Formula | C21H24ClN3O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-chloro-1-cyclohexyl-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione |
| SMILES | O=C(c1cccc(NC2=C(Cl)C(=O)N(C3CCCCC3)C2=O)c1O)N1CCOCC1 |
| InChI | InChI=1S/C21H24ClN3O5/c22-16-17(21(29)25(20(16)28)13-5-2-1-3-6-13)23-15-8-4-7-14(18(15)26)19(27)24-9-11-30-12-10-24/h4,7-8,13,23,26H,1-3,5-6,9-12H2 |
| InChIKey | DGXOYDSWNHFPRU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|