C18H38N2O9P2S2 — CID 175065393
1-cyclohexyl-3-morpholin-4-ylpyrrole-2,5-dione;ethane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (PubChem CID 175065393) has the molecular formula C18H38N2O9P2S2 and a molecular weight of 552.59 g/mol. Its IUPAC name is 1-cyclohexyl-3-morpholin-4-ylpyrrole-2,5-dione;ethane;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
| Compound Name | 1-cyclohexyl-3-morpholin-4-ylpyrrole-2,5-dione;ethane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
|---|---|
| PubChem CID | 175065393 |
| Molecular Formula | C18H38N2O9P2S2 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 1-cyclohexyl-3-morpholin-4-ylpyrrole-2,5-dione;ethane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| SMILES | CC.CC.O=C1C=C(N2CCOCC2)C(=O)N1C1CCCCC1.OP(O)(O)=S.OP(O)(O)=S |
| InChI | InChI=1S/C14H20N2O3.2C2H6.2H3O3PS/c17-13-10-12(15-6-8-19-9-7-15)14(18)16(13)11-4-2-1-3-5-11;2*1-2;2*1-4(2,3)5/h10-11H,1-9H2;2*1-2H3;2*(H3,1,2,3,5) |
| InChIKey | PJHGBLHGUVOCHG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 171.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|