C26H32FN3O4 — CID 46151701
N-[2-(diethylamino)-1-[1-(2-methoxybenzoyl)piperidin-4-yl]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 46151701) has the molecular formula C26H32FN3O4 and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[2-(diethylamino)-1-[1-(2-methoxybenzoyl)piperidin-4-yl]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(diethylamino)-1-[1-(2-methoxybenzoyl)piperidin-4-yl]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 46151701 |
| Molecular Formula | C26H32FN3O4 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[2-(diethylamino)-1-[1-(2-methoxybenzoyl)piperidin-4-yl]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | CCN(CC)C(=O)C(NC(=O)c1ccccc1F)C1CCN(C(=O)c2ccccc2OC)CC1 |
| InChI | InChI=1S/C26H32FN3O4/c1-4-29(5-2)26(33)23(28-24(31)19-10-6-8-12-21(19)27)18-14-16-30(17-15-18)25(32)20-11-7-9-13-22(20)34-3/h6-13,18,23H,4-5,14-17H2,1-3H3,(H,28,31) |
| InChIKey | SNOKDHNRMONILN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |