C25H29ClFN3O3 — CID 46014668
N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(diethylamino)-2-oxoethyl]-4-fluorobenzamide (PubChem CID 46014668) has the molecular formula C25H29ClFN3O3 and a molecular weight of 473.98 g/mol. Its IUPAC name is N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(diethylamino)-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(diethylamino)-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46014668 |
| Molecular Formula | C25H29ClFN3O3 |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(diethylamino)-2-oxoethyl]-4-fluorobenzamide |
| SMILES | CCN(CC)C(=O)C(NC(=O)c1ccc(F)cc1)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H29ClFN3O3/c1-3-29(4-2)25(33)22(28-23(31)18-7-11-21(27)12-8-18)17-13-15-30(16-14-17)24(32)19-5-9-20(26)10-6-19/h5-12,17,22H,3-4,13-16H2,1-2H3,(H,28,31) |
| InChIKey | ASNQZZAEINDQFN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |