C21H31FN4O2S — CID 93178875
N-[(1S)-2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 93178875) has the molecular formula C21H31FN4O2S and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[(1S)-2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[(1S)-2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 93178875 |
| Molecular Formula | C21H31FN4O2S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[(1S)-2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | CCNC(=S)N1CCC([C@H](NC(=O)c2ccc(F)cc2)C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C21H31FN4O2S/c1-4-23-21(29)26-13-11-15(12-14-26)18(20(28)25(5-2)6-3)24-19(27)16-7-9-17(22)10-8-16/h7-10,15,18H,4-6,11-14H2,1-3H3,(H,23,29)(H,24,27)/t18-/m0/s1 |
| InChIKey | ZINKFHPXLJQLLQ-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|