C22H34N4O3S — CID 46020741
N-[2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-3-methoxybenzamide (PubChem CID 46020741) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-3-methoxybenzamide.
| Compound Name | N-[2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 46020741 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[2-(diethylamino)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]-3-methoxybenzamide |
| SMILES | CCNC(=S)N1CCC(C(NC(=O)c2cccc(OC)c2)C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-5-23-22(30)26-13-11-16(12-14-26)19(21(28)25(6-2)7-3)24-20(27)17-9-8-10-18(15-17)29-4/h8-10,15-16,19H,5-7,11-14H2,1-4H3,(H,23,30)(H,24,27) |
| InChIKey | YFPGDIPRGKFQQH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|