(Z)-3-aminoprop-2-enoic acid

C3H5NO2 — CID 46173136

IUPAC(Z)-3-aminoprop-2-enoic acid
SMILESN/C=C\C(=O)O
InChIInChI=1S/C3H5NO2/c4-2-1-3(5)6/h1-2H,4H2,(H,5,6)/b2-1-
InChIKeyYTLYLLTVENPWFT-UPHRSURJSA-N
MW87.08 g/mol
LogP-0.46
Rot. Bonds1

About (Z)-3-aminoprop-2-enoic acid

(Z)-3-aminoprop-2-enoic acid (PubChem CID 46173136) has the molecular formula C3H5NO2 and a molecular weight of 87.08 g/mol. Its IUPAC name is (Z)-3-aminoprop-2-enoic acid.

Molecular Properties

Compound Name(Z)-3-aminoprop-2-enoic acid
PubChem CID46173136
Molecular FormulaC3H5NO2
Molecular Weight87.08 g/mol
Exact Mass87.03
IUPAC Name(Z)-3-aminoprop-2-enoic acid
SMILESN/C=C\C(=O)O
InChIInChI=1S/C3H5NO2/c4-2-1-3(5)6/h1-2H,4H2,(H,5,6)/b2-1-
InChIKeyYTLYLLTVENPWFT-UPHRSURJSA-N
XLogP-0.46
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50087.08
LogP ≤ 5-0.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-3-aminoprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-3-aminoprop-2-enoic acid?
The IUPAC name of (Z)-3-aminoprop-2-enoic acid (CID 46173136) is (Z)-3-aminoprop-2-enoic acid.
What is the SMILES notation for (Z)-3-aminoprop-2-enoic acid?
The canonical SMILES for (Z)-3-aminoprop-2-enoic acid is N/C=C\C(=O)O.
What is the InChIKey of (Z)-3-aminoprop-2-enoic acid?
The InChIKey is YTLYLLTVENPWFT-UPHRSURJSA-N. The full InChI is InChI=1S/C3H5NO2/c4-2-1-3(5)6/h1-2H,4H2,(H,5,6)/b2-1-.
What are the key properties of (Z)-3-aminoprop-2-enoic acid?
(Z)-3-aminoprop-2-enoic acid has a molecular weight of 87.08 g/mol, XLogP of -0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-aminoprop-2-enoic acid is sourced from PubChem (CID 46173136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).