C29H30FNO6 — CID 46176733
dibenzyl 2-[(R)-(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate (PubChem CID 46176733) has the molecular formula C29H30FNO6 and a molecular weight of 507.56 g/mol. Its IUPAC name is dibenzyl 2-[(R)-(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate.
| Compound Name | dibenzyl 2-[(R)-(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate |
|---|---|
| PubChem CID | 46176733 |
| Molecular Formula | C29H30FNO6 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | dibenzyl 2-[(R)-(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccc(F)cc1)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H30FNO6/c1-29(2,3)37-28(34)31-25(22-14-16-23(30)17-15-22)24(26(32)35-18-20-10-6-4-7-11-20)27(33)36-19-21-12-8-5-9-13-21/h4-17,24-25H,18-19H2,1-3H3,(H,31,34)/t25-/m0/s1 |
| InChIKey | HBYIDYDDHFMELT-VWLOTQADSA-N |
| XLogP | 5.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|