C15H19ClO — CID 46176896
1-chloro-4-[2-(cyclohexen-1-yl)-1-methoxyethyl]benzene (PubChem CID 46176896) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is 1-chloro-4-[2-(cyclohexen-1-yl)-1-methoxyethyl]benzene.
| Compound Name | 1-chloro-4-[2-(cyclohexen-1-yl)-1-methoxyethyl]benzene |
|---|---|
| PubChem CID | 46176896 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-chloro-4-[2-(cyclohexen-1-yl)-1-methoxyethyl]benzene |
| SMILES | COC(CC1=CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClO/c1-17-15(11-12-5-3-2-4-6-12)13-7-9-14(16)10-8-13/h5,7-10,15H,2-4,6,11H2,1H3 |
| InChIKey | XDIDJEXDRCXACF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|