C29H23NO2S3 — CID 46177633
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(4-methylphenyl)carbamodithioate (PubChem CID 46177633) has the molecular formula C29H23NO2S3 and a molecular weight of 513.71 g/mol. Its IUPAC name is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(4-methylphenyl)carbamodithioate.
| Compound Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(4-methylphenyl)carbamodithioate |
|---|---|
| PubChem CID | 46177633 |
| Molecular Formula | C29H23NO2S3 |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(4-methylphenyl)carbamodithioate |
| SMILES | Cc1ccc(NC(=S)SC(CC(=O)c2ccc3c(c2)Sc2ccccc2O3)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23NO2S3/c1-19-11-14-22(15-12-19)30-29(33)35-27(20-7-3-2-4-8-20)18-23(31)21-13-16-25-28(17-21)34-26-10-6-5-9-24(26)32-25/h2-17,27H,18H2,1H3,(H,30,33) |
| InChIKey | GDFZMYKWEKDUKJ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|