C25H27N5O — CID 46183034
N-[(E)-isoquinolin-5-ylmethylideneamino]-2-methyl-2-(4-piperazin-1-ylphenyl)cyclopropane-1-carboxamide (PubChem CID 46183034) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is N-[(E)-isoquinolin-5-ylmethylideneamino]-2-methyl-2-(4-piperazin-1-ylphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(E)-isoquinolin-5-ylmethylideneamino]-2-methyl-2-(4-piperazin-1-ylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46183034 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[(E)-isoquinolin-5-ylmethylideneamino]-2-methyl-2-(4-piperazin-1-ylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC1(c2ccc(N3CCNCC3)cc2)CC1C(=O)N/N=C/c1cccc2cnccc12 |
| InChI | InChI=1S/C25H27N5O/c1-25(20-5-7-21(8-6-20)30-13-11-26-12-14-30)15-23(25)24(31)29-28-17-19-4-2-3-18-16-27-10-9-22(18)19/h2-10,16-17,23,26H,11-15H2,1H3,(H,29,31)/b28-17+ |
| InChIKey | YXRLZWIYONNDHP-OGLMXYFKSA-N |
| XLogP | 3.07 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|