C25H26N4O2 — CID 46183271
2-amino-N-[(E)-isoquinolin-5-ylmethylideneamino]-2-[4-(oxan-4-yl)phenyl]cyclopropane-1-carboxamide (PubChem CID 46183271) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-amino-N-[(E)-isoquinolin-5-ylmethylideneamino]-2-[4-(oxan-4-yl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-amino-N-[(E)-isoquinolin-5-ylmethylideneamino]-2-[4-(oxan-4-yl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46183271 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-amino-N-[(E)-isoquinolin-5-ylmethylideneamino]-2-[4-(oxan-4-yl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC1(c2ccc(C3CCOCC3)cc2)CC1C(=O)N/N=C/c1cccc2cnccc12 |
| InChI | InChI=1S/C25H26N4O2/c26-25(21-6-4-17(5-7-21)18-9-12-31-13-10-18)14-23(25)24(30)29-28-16-20-3-1-2-19-15-27-11-8-22(19)20/h1-8,11,15-16,18,23H,9-10,12-14,26H2,(H,29,30)/b28-16+ |
| InChIKey | AMBHCZRMFPKSGX-LQKURTRISA-N |
| XLogP | 3.45 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|