C20H28O5 — CID 46184745
ethyl (2E,8E)-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-7-oxonona-2,8-dienoate (PubChem CID 46184745) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl (2E,8E)-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-7-oxonona-2,8-dienoate.
| Compound Name | ethyl (2E,8E)-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-7-oxonona-2,8-dienoate |
|---|---|
| PubChem CID | 46184745 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | ethyl (2E,8E)-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-7-oxonona-2,8-dienoate |
| SMILES | C#CCC[C@@H]1OC(C)(C)O[C@H]1/C=C/C(=O)CCC/C=C/C(=O)OCC |
| InChI | InChI=1S/C20H28O5/c1-5-7-12-17-18(25-20(3,4)24-17)15-14-16(21)11-9-8-10-13-19(22)23-6-2/h1,10,13-15,17-18H,6-9,11-12H2,2-4H3/b13-10+,15-14+/t17-,18-/m0/s1 |
| InChIKey | QQFPOVLLZUSDTI-FDAVVDFGSA-N |
| XLogP | 3.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|