C26H34O5 — CID 142601414
methyl (4Z,8E,12E,14E)-15-[(4R,5S)-2,2-dimethyl-5-[(Z)-pent-2-enyl]-1,3-dioxolan-4-yl]-7-oxopentadeca-4,8,12,14-tetraen-10-ynoate (PubChem CID 142601414) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is methyl (4Z,8E,12E,14E)-15-[(4R,5S)-2,2-dimethyl-5-[(Z)-pent-2-enyl]-1,3-dioxolan-4-yl]-7-oxopentadeca-4,8,12,14-tetraen-10-ynoate.
| Compound Name | methyl (4Z,8E,12E,14E)-15-[(4R,5S)-2,2-dimethyl-5-[(Z)-pent-2-enyl]-1,3-dioxolan-4-yl]-7-oxopentadeca-4,8,12,14-tetraen-10-ynoate |
|---|---|
| PubChem CID | 142601414 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | methyl (4Z,8E,12E,14E)-15-[(4R,5S)-2,2-dimethyl-5-[(Z)-pent-2-enyl]-1,3-dioxolan-4-yl]-7-oxopentadeca-4,8,12,14-tetraen-10-ynoate |
| SMILES | CC/C=C\C[C@@H]1OC(C)(C)O[C@@H]1/C=C/C=C/C#C/C=C/C(=O)C/C=C\CCC(=O)OC |
| InChI | InChI=1S/C26H34O5/c1-5-6-12-19-23-24(31-26(2,3)30-23)20-15-10-8-7-9-13-17-22(27)18-14-11-16-21-25(28)29-4/h6,8,10-15,17,20,23-24H,5,16,18-19,21H2,1-4H3/b10-8+,12-6-,14-11-,17-13+,20-15+/t23-,24+/m0/s1 |
| InChIKey | VPVDKVMQOLDMBT-APNGTKLXSA-N |
| XLogP | 5.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|