C17H15Br2N3O — CID 46185139
2-[4-[(4-bromophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-1-phenylethanone bromide (PubChem CID 46185139) has the molecular formula C17H15Br2N3O and a molecular weight of 437.14 g/mol. Its IUPAC name is 2-[4-[(4-bromophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-1-phenylethanone bromide.
| Compound Name | 2-[4-[(4-bromophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-1-phenylethanone bromide |
|---|---|
| PubChem CID | 46185139 |
| Molecular Formula | C17H15Br2N3O |
| Molecular Weight | 437.14 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | 2-[4-[(4-bromophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]-1-phenylethanone bromide |
| SMILES | O=C(Cn1c[n+](Cc2ccc(Br)cc2)cn1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C17H15BrN3O.BrH/c18-16-8-6-14(7-9-16)10-20-12-19-21(13-20)11-17(22)15-4-2-1-3-5-15;/h1-9,12-13H,10-11H2;1H/q+1;/p-1 |
| InChIKey | BOENZYMHOZSUMA-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|