C10H11N4O+ — CID 774934
2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-phenylethanone (PubChem CID 774934) has the molecular formula C10H11N4O+ and a molecular weight of 203.23 g/mol. Its IUPAC name is 2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-phenylethanone.
| Compound Name | 2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 774934 |
| Molecular Formula | C10H11N4O+ |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-phenylethanone |
| SMILES | N[n+]1cnn(CC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C10H11N4O/c11-13-7-12-14(8-13)6-10(15)9-4-2-1-3-5-9/h1-5,7-8H,6,11H2/q+1 |
| InChIKey | GCPOUIZZAOLTHU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|