C17H16Cl2FNO4S — CID 46190777
ethyl 2-[3-chloro-4-(4-chloro-3-fluorophenyl)-N-methylsulfonylanilino]acetate (PubChem CID 46190777) has the molecular formula C17H16Cl2FNO4S and a molecular weight of 420.29 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-(4-chloro-3-fluorophenyl)-N-methylsulfonylanilino]acetate.
| Compound Name | ethyl 2-[3-chloro-4-(4-chloro-3-fluorophenyl)-N-methylsulfonylanilino]acetate |
|---|---|
| PubChem CID | 46190777 |
| Molecular Formula | C17H16Cl2FNO4S |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | ethyl 2-[3-chloro-4-(4-chloro-3-fluorophenyl)-N-methylsulfonylanilino]acetate |
| SMILES | CCOC(=O)CN(c1ccc(-c2ccc(Cl)c(F)c2)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H16Cl2FNO4S/c1-3-25-17(22)10-21(26(2,23)24)12-5-6-13(15(19)9-12)11-4-7-14(18)16(20)8-11/h4-9H,3,10H2,1-2H3 |
| InChIKey | SWLKQTNGHQLEDG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |