C19H20Cl2FNO4S — CID 68620004
tert-butyl 2-[3-chloro-4-(3-chloro-4-fluorophenyl)-N-methylsulfonylanilino]acetate (PubChem CID 68620004) has the molecular formula C19H20Cl2FNO4S and a molecular weight of 448.34 g/mol. Its IUPAC name is tert-butyl 2-[3-chloro-4-(3-chloro-4-fluorophenyl)-N-methylsulfonylanilino]acetate.
| Compound Name | tert-butyl 2-[3-chloro-4-(3-chloro-4-fluorophenyl)-N-methylsulfonylanilino]acetate |
|---|---|
| PubChem CID | 68620004 |
| Molecular Formula | C19H20Cl2FNO4S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | tert-butyl 2-[3-chloro-4-(3-chloro-4-fluorophenyl)-N-methylsulfonylanilino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1ccc(-c2ccc(F)c(Cl)c2)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H20Cl2FNO4S/c1-19(2,3)27-18(24)11-23(28(4,25)26)13-6-7-14(15(20)10-13)12-5-8-17(22)16(21)9-12/h5-10H,11H2,1-4H3 |
| InChIKey | RCADYOQZWLWQHJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |