C16H16Cl2FNO3S — CID 68619182
N-[3-chloro-4-(4-chloro-3-fluorophenyl)phenyl]-N-(2-methoxyethyl)methanesulfonamide (PubChem CID 68619182) has the molecular formula C16H16Cl2FNO3S and a molecular weight of 392.28 g/mol. Its IUPAC name is N-[3-chloro-4-(4-chloro-3-fluorophenyl)phenyl]-N-(2-methoxyethyl)methanesulfonamide.
| Compound Name | N-[3-chloro-4-(4-chloro-3-fluorophenyl)phenyl]-N-(2-methoxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 68619182 |
| Molecular Formula | C16H16Cl2FNO3S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-[3-chloro-4-(4-chloro-3-fluorophenyl)phenyl]-N-(2-methoxyethyl)methanesulfonamide |
| SMILES | COCCN(c1ccc(-c2ccc(Cl)c(F)c2)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H16Cl2FNO3S/c1-23-8-7-20(24(2,21)22)12-4-5-13(15(18)10-12)11-3-6-14(17)16(19)9-11/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | IRVXWAWFLSSCJI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |