C20H21ClF3NO4S — CID 140550551
tert-butyl 2-[3-chloro-N-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]acetate (PubChem CID 140550551) has the molecular formula C20H21ClF3NO4S and a molecular weight of 463.91 g/mol. Its IUPAC name is tert-butyl 2-[3-chloro-N-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]acetate.
| Compound Name | tert-butyl 2-[3-chloro-N-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]acetate |
|---|---|
| PubChem CID | 140550551 |
| Molecular Formula | C20H21ClF3NO4S |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | tert-butyl 2-[3-chloro-N-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1ccc(-c2ccc(C(F)(F)F)cc2)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H21ClF3NO4S/c1-19(2,3)29-18(26)12-25(30(4,27)28)15-9-10-16(17(21)11-15)13-5-7-14(8-6-13)20(22,23)24/h5-11H,12H2,1-4H3 |
| InChIKey | BXMHINBVLNWWLV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |