C26H22ClN3O4 — CID 46192204
(2R,5S)-5-benzyl-1-(5-chloro-2-nitrobenzoyl)-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one (PubChem CID 46192204) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is (2R,5S)-5-benzyl-1-(5-chloro-2-nitrobenzoyl)-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one.
| Compound Name | (2R,5S)-5-benzyl-1-(5-chloro-2-nitrobenzoyl)-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 46192204 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (2R,5S)-5-benzyl-1-(5-chloro-2-nitrobenzoyl)-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one |
| SMILES | C=C(c1ccccc1)[C@@H]1N(C)C(=O)[C@H](Cc2ccccc2)N1C(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H22ClN3O4/c1-17(19-11-7-4-8-12-19)24-28(2)26(32)23(15-18-9-5-3-6-10-18)29(24)25(31)21-16-20(27)13-14-22(21)30(33)34/h3-14,16,23-24H,1,15H2,2H3/t23-,24+/m0/s1 |
| InChIKey | YETANWKFWCULEU-BJKOFHAPSA-N |
| XLogP | 4.81 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|