C23H28O5S — CID 46192908
1-[cyclohex-2-en-1-yl-(4-methylphenyl)sulfonylmethyl]-2,4,5-trimethoxybenzene (PubChem CID 46192908) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is 1-[cyclohex-2-en-1-yl-(4-methylphenyl)sulfonylmethyl]-2,4,5-trimethoxybenzene.
| Compound Name | 1-[cyclohex-2-en-1-yl-(4-methylphenyl)sulfonylmethyl]-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 46192908 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[cyclohex-2-en-1-yl-(4-methylphenyl)sulfonylmethyl]-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(C2C=CCCC2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C23H28O5S/c1-16-10-12-18(13-11-16)29(24,25)23(17-8-6-5-7-9-17)19-14-21(27-3)22(28-4)15-20(19)26-2/h6,8,10-15,17,23H,5,7,9H2,1-4H3 |
| InChIKey | KJQGLDAJDYGWBK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|